ChemNet > CAS > 57601-89-5 methyl 2-[(cyanomethyl)thio]benzoate
57601-89-5 methyl 2-[(cyanomethyl)thio]benzoate
| product Name |
methyl 2-[(cyanomethyl)thio]benzoate |
| CAS No |
57601-89-5 |
| Synonyms |
methyl 2-[(cyanomethyl)sulfanyl]benzoate |
| Molecular Formula |
C10H9NO2S |
| Molecular Weight |
207.249 |
| InChI |
InChI=1/C10H9NO2S/c1-13-10(12)8-4-2-3-5-9(8)14-7-6-11/h2-5H,7H2,1H3 |
| Molecular Structure |
![57601-89-5 methyl 2-[(cyanomethyl)thio]benzoate](https://images-a.chemnet.com/suppliers/chembase/143/14321.gif)
|
| Density |
1.24g/cm3 |
| Melting point |
121℃ |
| Boiling point |
338.6°C at 760 mmHg |
| Refractive index |
1.574 |
| Flash point |
158.6°C |
| Vapour Pressur |
9.69E-05mmHg at 25°C |
| Hazard Symbols |
 Xn:Harmful;
|
| Risk Codes |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| Safety Description |
S36/37:Wear suitable protective clothing and gloves.;
|
| MSDS |
Material Safety Data Sheet
|
|
